Benzyl-2,3,4,5,6-d5-dimethyltetradecylammonium Bromide50mg
Benzyl-2,3,4,5,6-d5-dimethyltetradecylammonium Bromide (CAS: 1515861-68-3) has the chemical formula CH3(CH2)13N(Br)(CH3)2CH2C6D5 and a molecular weight of 416.28 g/mol It typically appears as white solid with a purity of 99 atom % D and a flash point of nan commonly used in chemical synthesis or laboratory applications.
Your Dynamic Snippet will be displayed here... This message is displayed because you did not provided both a filter and a template to use.