Oleylamine, min. 95%5g
Oleylamine, min. 95% (CAS: 112-90-3) has the chemical formula CH3(CH2)7CHCH(CH2)7CH2NH2 and a molecular weight of 267.49 g/mol It typically appears as colorless liq. with a purity of min. 95% and a flash point of nan commonly used in chemical synthesis or laboratory applications.
Your Dynamic Snippet will be displayed here... This message is displayed because you did not provided both a filter and a template to use.